About 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine
2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine (PubChem CID 55280138) has the molecular formula C8H11N3OS
and a molecular weight of 197.26 g/mol. Its IUPAC name is 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine |
| PubChem CID | 55280138 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine |
| SMILES | CSc1ncc2c(n1)OCC(N)C2 |
| InChI | InChI=1S/C8H11N3OS/c1-13-8-10-3-5-2-6(9)4-12-7(5)11-8/h3,6H,2,4,9H2,1H3 |
| InChIKey | GCWPVLPRVLRPHT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine?
The IUPAC name of 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine (CID 55280138) is 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine.
What is the SMILES notation for 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine?
The canonical SMILES for 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine is CSc1ncc2c(n1)OCC(N)C2.
What is the InChIKey of 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine?
The InChIKey is GCWPVLPRVLRPHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3OS/c1-13-8-10-3-5-2-6(9)4-12-7(5)11-8/h3,6H,2,4,9H2,1H3.
What are the key properties of 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine?
2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine has a molecular weight of 197.26 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidin-6-amine is sourced from PubChem (CID 55280138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).