C8H8N2S2 — CID 154445960
2-methylsulfanyl-5H-thiopyrano[4,3-d]pyrimidine (PubChem CID 154445960) has the molecular formula C8H8N2S2 and a molecular weight of 196.30 g/mol. Its IUPAC name is 2-methylsulfanyl-5H-thiopyrano[4,3-d]pyrimidine.
| Compound Name | 2-methylsulfanyl-5H-thiopyrano[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 154445960 |
| Molecular Formula | C8H8N2S2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 2-methylsulfanyl-5H-thiopyrano[4,3-d]pyrimidine |
| SMILES | CSc1ncc2c(n1)C=CSC2 |
| InChI | InChI=1S/C8H8N2S2/c1-11-8-9-4-6-5-12-3-2-7(6)10-8/h2-4H,5H2,1H3 |
| InChIKey | RGRXVMWRLBDUGR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |