About 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine
5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine (PubChem CID 90356390) has the molecular formula C6H5N3S2
and a molecular weight of 183.26 g/mol. Its IUPAC name is 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine.
Analyze 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine?
The IUPAC name of 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine (CID 90356390) is 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine?
The canonical SMILES for 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine is CSc1ncc2ncsc2n1.
What is the InChIKey of 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine?
The InChIKey is LOMYGAZCFNCKGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S2/c1-10-6-7-2-4-5(9-6)11-3-8-4/h2-3H,1H3.
What are the key properties of 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine?
5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine has a molecular weight of 183.26 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 90356390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).