C6H5N3S — CID 592016
5-methyl-[1,3]thiazolo[5,4-d]pyrimidine (PubChem CID 592016) has the molecular formula C6H5N3S and a molecular weight of 151.19 g/mol. Its IUPAC name is 5-methyl-[1,3]thiazolo[5,4-d]pyrimidine.
| Compound Name | 5-methyl-[1,3]thiazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 592016 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 5-methyl-[1,3]thiazolo[5,4-d]pyrimidine |
| SMILES | Cc1ncc2ncsc2n1 |
| InChI | InChI=1S/C6H5N3S/c1-4-7-2-5-6(9-4)10-3-8-5/h2-3H,1H3 |
| InChIKey | MMOQXBUGBFDEKS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |