C8H8ClN4S+ — CID 170257632
4-chloro-3-methyl-6-methylsulfanylpyrimido[5,4-d]pyrimidin-3-ium (PubChem CID 170257632) has the molecular formula C8H8ClN4S+ and a molecular weight of 227.70 g/mol. Its IUPAC name is 4-chloro-3-methyl-6-methylsulfanylpyrimido[5,4-d]pyrimidin-3-ium.
| Compound Name | 4-chloro-3-methyl-6-methylsulfanylpyrimido[5,4-d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 170257632 |
| Molecular Formula | C8H8ClN4S+ |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 4-chloro-3-methyl-6-methylsulfanylpyrimido[5,4-d]pyrimidin-3-ium |
| SMILES | CSc1ncc2nc[n+](C)c(Cl)c2n1 |
| InChI | InChI=1S/C8H8ClN4S/c1-13-4-11-5-3-10-8(14-2)12-6(5)7(13)9/h3-4H,1-2H3/q+1 |
| InChIKey | SWEIWVNGTFIRRR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|