About 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine
4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine (PubChem CID 129147092) has the molecular formula C9H8N4S
and a molecular weight of 204.26 g/mol. Its IUPAC name is 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine |
| PubChem CID | 129147092 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine |
| SMILES | C=Cc1ncnc2cnc(SC)nc12 |
| InChI | InChI=1S/C9H8N4S/c1-3-6-8-7(12-5-11-6)4-10-9(13-8)14-2/h3-5H,1H2,2H3 |
| InChIKey | BLQUDAFJLPJRER-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine?
The IUPAC name of 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine (CID 129147092) is 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine.
What is the SMILES notation for 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine?
The canonical SMILES for 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine is C=Cc1ncnc2cnc(SC)nc12.
What is the InChIKey of 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine?
The InChIKey is BLQUDAFJLPJRER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4S/c1-3-6-8-7(12-5-11-6)4-10-9(13-8)14-2/h3-5H,1H2,2H3.
What are the key properties of 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine?
4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine has a molecular weight of 204.26 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-6-methylsulfanylpyrimido[5,4-d]pyrimidine is sourced from PubChem (CID 129147092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).