About 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine
7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 139269700) has the molecular formula C7H6ClN3S
and a molecular weight of 199.67 g/mol. Its IUPAC name is 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine.
Analyze 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine?
The IUPAC name of 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine (CID 139269700) is 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine?
The canonical SMILES for 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine is CSc1ncc2[nH]cc(Cl)c2n1.
What is the InChIKey of 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine?
The InChIKey is XLXVHYUQXIFHEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3S/c1-12-7-10-3-5-6(11-7)4(8)2-9-5/h2-3,9H,1H3.
What are the key properties of 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine?
7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine has a molecular weight of 199.67 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-methylsulfanyl-5H-pyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 139269700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).