C8H6Cl2FN3S — CID 172607543
5,7-dichloro-8-fluoro-2-methylsulfanyl-6,7-dihydropyrido[4,3-d]pyrimidine (PubChem CID 172607543) has the molecular formula C8H6Cl2FN3S and a molecular weight of 266.13 g/mol. Its IUPAC name is 5,7-dichloro-8-fluoro-2-methylsulfanyl-6,7-dihydropyrido[4,3-d]pyrimidine.
| Compound Name | 5,7-dichloro-8-fluoro-2-methylsulfanyl-6,7-dihydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 172607543 |
| Molecular Formula | C8H6Cl2FN3S |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 264.96 |
| IUPAC Name | 5,7-dichloro-8-fluoro-2-methylsulfanyl-6,7-dihydropyrido[4,3-d]pyrimidine |
| SMILES | CSc1ncc2c(n1)=C(F)C(Cl)NC=2Cl |
| InChI | InChI=1S/C8H6Cl2FN3S/c1-15-8-12-2-3-5(13-8)4(11)7(10)14-6(3)9/h2,7,14H,1H3 |
| InChIKey | QFECKJHEICINJC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|