C11H16N2 — CID 142881444
2,3-bis(ethenyl)-5-methylpyrazine;ethane (PubChem CID 142881444) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-5-methylpyrazine;ethane.
| Compound Name | 2,3-bis(ethenyl)-5-methylpyrazine;ethane |
|---|---|
| PubChem CID | 142881444 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,3-bis(ethenyl)-5-methylpyrazine;ethane |
| SMILES | C=Cc1ncc(C)nc1C=C.CC |
| InChI | InChI=1S/C9H10N2.C2H6/c1-4-8-9(5-2)11-7(3)6-10-8;1-2/h4-6H,1-2H2,3H3;1-2H3 |
| InChIKey | PBUZJIKIMJZDNL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |