C8H14N2 — CID 54569544
2,6-dimethylpyrazine;ethane (PubChem CID 54569544) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2,6-dimethylpyrazine;ethane.
| Compound Name | 2,6-dimethylpyrazine;ethane |
|---|---|
| PubChem CID | 54569544 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2,6-dimethylpyrazine;ethane |
| SMILES | CC.Cc1cncc(C)n1 |
| InChI | InChI=1S/C6H8N2.C2H6/c1-5-3-7-4-6(2)8-5;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | ZWGRXVIEJFIULD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |