About ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine
ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine (PubChem CID 169251343) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine.
Molecular Properties
| Compound Name | ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine |
| PubChem CID | 169251343 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine |
| SMILES | CC.CO.Cc1cncc(N2CCCC2)n1 |
| InChI | InChI=1S/C9H13N3.C2H6.CH4O/c1-8-6-10-7-9(11-8)12-4-2-3-5-12;2*1-2/h6-7H,2-5H2,1H3;1-2H3;2H,1H3 |
| InChIKey | POSYKKHRUVQZTH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine?
The IUPAC name of ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine (CID 169251343) is ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine.
What is the SMILES notation for ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine?
The canonical SMILES for ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine is CC.CO.Cc1cncc(N2CCCC2)n1.
What is the InChIKey of ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine?
The InChIKey is POSYKKHRUVQZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3.C2H6.CH4O/c1-8-6-10-7-9(11-8)12-4-2-3-5-12;2*1-2/h6-7H,2-5H2,1H3;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine?
ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine has a molecular weight of 225.34 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;2-methyl-6-pyrrolidin-1-ylpyrazine is sourced from PubChem (CID 169251343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).