C17H26N4O — CID 133469560
2-cyclohexyl-1-[4-(6-methylpyrazin-2-yl)piperazin-1-yl]ethanone (PubChem CID 133469560) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-cyclohexyl-1-[4-(6-methylpyrazin-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-cyclohexyl-1-[4-(6-methylpyrazin-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 133469560 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-cyclohexyl-1-[4-(6-methylpyrazin-2-yl)piperazin-1-yl]ethanone |
| SMILES | Cc1cncc(N2CCN(C(=O)CC3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C17H26N4O/c1-14-12-18-13-16(19-14)20-7-9-21(10-8-20)17(22)11-15-5-3-2-4-6-15/h12-13,15H,2-11H2,1H3 |
| InChIKey | HRLVTRZUKGLGGN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |