C15H22N4OS — CID 155799937
[1-(6-methylpyrazin-2-yl)piperidin-3-yl]-thiomorpholin-4-ylmethanone (PubChem CID 155799937) has the molecular formula C15H22N4OS and a molecular weight of 306.43 g/mol. Its IUPAC name is [1-(6-methylpyrazin-2-yl)piperidin-3-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-(6-methylpyrazin-2-yl)piperidin-3-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 155799937 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [1-(6-methylpyrazin-2-yl)piperidin-3-yl]-thiomorpholin-4-ylmethanone |
| SMILES | Cc1cncc(N2CCCC(C(=O)N3CCSCC3)C2)n1 |
| InChI | InChI=1S/C15H22N4OS/c1-12-9-16-10-14(17-12)19-4-2-3-13(11-19)15(20)18-5-7-21-8-6-18/h9-10,13H,2-8,11H2,1H3 |
| InChIKey | LHCVQHODWDTSDX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |