C15H20BrN3OS — CID 163343452
[1-(3-bromo-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone (PubChem CID 163343452) has the molecular formula C15H20BrN3OS and a molecular weight of 370.32 g/mol. Its IUPAC name is [1-(3-bromo-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-(3-bromo-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 163343452 |
| Molecular Formula | C15H20BrN3OS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | [1-(3-bromo-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(C1CCCN(c2ncccc2Br)C1)N1CCSCC1 |
| InChI | InChI=1S/C15H20BrN3OS/c16-13-4-1-5-17-14(13)19-6-2-3-12(11-19)15(20)18-7-9-21-10-8-18/h1,4-5,12H,2-3,6-11H2 |
| InChIKey | OQNRESIOGQGJTF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |