C15H20ClN3OS — CID 163357788
[1-(3-chloro-2-pyridinyl)piperidin-4-yl]-thiomorpholin-4-ylmethanone (PubChem CID 163357788) has the molecular formula C15H20ClN3OS and a molecular weight of 325.87 g/mol. Its IUPAC name is [1-(3-chloro-2-pyridinyl)piperidin-4-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-(3-chloro-2-pyridinyl)piperidin-4-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 163357788 |
| Molecular Formula | C15H20ClN3OS |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [1-(3-chloro-2-pyridinyl)piperidin-4-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(C1CCN(c2ncccc2Cl)CC1)N1CCSCC1 |
| InChI | InChI=1S/C15H20ClN3OS/c16-13-2-1-5-17-14(13)18-6-3-12(4-7-18)15(20)19-8-10-21-11-9-19/h1-2,5,12H,3-4,6-11H2 |
| InChIKey | YZTWBSKPJKZPES-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |