C16H25N5OS — CID 163357851
[1-[4-(dimethylamino)pyrimidin-2-yl]piperidin-4-yl]-thiomorpholin-4-ylmethanone (PubChem CID 163357851) has the molecular formula C16H25N5OS and a molecular weight of 335.48 g/mol. Its IUPAC name is [1-[4-(dimethylamino)pyrimidin-2-yl]piperidin-4-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-[4-(dimethylamino)pyrimidin-2-yl]piperidin-4-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 163357851 |
| Molecular Formula | C16H25N5OS |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [1-[4-(dimethylamino)pyrimidin-2-yl]piperidin-4-yl]-thiomorpholin-4-ylmethanone |
| SMILES | CN(C)c1ccnc(N2CCC(C(=O)N3CCSCC3)CC2)n1 |
| InChI | InChI=1S/C16H25N5OS/c1-19(2)14-3-6-17-16(18-14)21-7-4-13(5-8-21)15(22)20-9-11-23-12-10-20/h3,6,13H,4-5,7-12H2,1-2H3 |
| InChIKey | JIJRPZLRKSYQOY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |