C14H19N7O — CID 126948012
1-[1-[4-(dimethylamino)pyrimidin-2-yl]pyrrolidin-3-yl]pyrazole-4-carboxamide (PubChem CID 126948012) has the molecular formula C14H19N7O and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-[1-[4-(dimethylamino)pyrimidin-2-yl]pyrrolidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1-[1-[4-(dimethylamino)pyrimidin-2-yl]pyrrolidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 126948012 |
| Molecular Formula | C14H19N7O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-[1-[4-(dimethylamino)pyrimidin-2-yl]pyrrolidin-3-yl]pyrazole-4-carboxamide |
| SMILES | CN(C)c1ccnc(N2CCC(n3cc(C(N)=O)cn3)C2)n1 |
| InChI | InChI=1S/C14H19N7O/c1-19(2)12-3-5-16-14(18-12)20-6-4-11(9-20)21-8-10(7-17-21)13(15)22/h3,5,7-8,11H,4,6,9H2,1-2H3,(H2,15,22) |
| InChIKey | AKJMULWBPBAEKO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |