C15H23N5O2 — CID 163345813
[4-[4-(dimethylamino)pyrimidin-2-yl]morpholin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 163345813) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is [4-[4-(dimethylamino)pyrimidin-2-yl]morpholin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[4-(dimethylamino)pyrimidin-2-yl]morpholin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 163345813 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | [4-[4-(dimethylamino)pyrimidin-2-yl]morpholin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CN(C)c1ccnc(N2CCOC(C(=O)N3CCCC3)C2)n1 |
| InChI | InChI=1S/C15H23N5O2/c1-18(2)13-5-6-16-15(17-13)20-9-10-22-12(11-20)14(21)19-7-3-4-8-19/h5-6,12H,3-4,7-11H2,1-2H3 |
| InChIKey | XAOQMTYDBRPIDW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |