C14H18BrN3O2 — CID 163343615
[4-(3-bromo-4-pyridinyl)morpholin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 163343615) has the molecular formula C14H18BrN3O2 and a molecular weight of 340.22 g/mol. Its IUPAC name is [4-(3-bromo-4-pyridinyl)morpholin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-(3-bromo-4-pyridinyl)morpholin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 163343615 |
| Molecular Formula | C14H18BrN3O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | [4-(3-bromo-4-pyridinyl)morpholin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CN(c2ccncc2Br)CCO1)N1CCCC1 |
| InChI | InChI=1S/C14H18BrN3O2/c15-11-9-16-4-3-12(11)18-7-8-20-13(10-18)14(19)17-5-1-2-6-17/h3-4,9,13H,1-2,5-8,10H2 |
| InChIKey | WWYQEZPWCXUVGR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |