C14H19ClN4OS — CID 124594638
N-[(3R)-1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]thiomorpholine-4-carboxamide (PubChem CID 124594638) has the molecular formula C14H19ClN4OS and a molecular weight of 326.85 g/mol. Its IUPAC name is N-[(3R)-1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]thiomorpholine-4-carboxamide.
| Compound Name | N-[(3R)-1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 124594638 |
| Molecular Formula | C14H19ClN4OS |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[(3R)-1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]thiomorpholine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(c2ncccc2Cl)C1)N1CCSCC1 |
| InChI | InChI=1S/C14H19ClN4OS/c15-12-2-1-4-16-13(12)19-5-3-11(10-19)17-14(20)18-6-8-21-9-7-18/h1-2,4,11H,3,5-10H2,(H,17,20)/t11-/m1/s1 |
| InChIKey | YKOMBYPXEDKDFF-LLVKDONJSA-N |
| XLogP | 2.07 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |