C18H28ClN5O — CID 166217431
N-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-3-(diethylamino)pyrrolidine-1-carboxamide (PubChem CID 166217431) has the molecular formula C18H28ClN5O and a molecular weight of 365.91 g/mol. Its IUPAC name is N-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-3-(diethylamino)pyrrolidine-1-carboxamide.
| Compound Name | N-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-3-(diethylamino)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 166217431 |
| Molecular Formula | C18H28ClN5O |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-3-(diethylamino)pyrrolidine-1-carboxamide |
| SMILES | CCN(CC)C1CCN(C(=O)NC2CCN(c3ncccc3Cl)C2)C1 |
| InChI | InChI=1S/C18H28ClN5O/c1-3-22(4-2)15-8-11-24(13-15)18(25)21-14-7-10-23(12-14)17-16(19)6-5-9-20-17/h5-6,9,14-15H,3-4,7-8,10-13H2,1-2H3,(H,21,25) |
| InChIKey | QQDFEEAZMKQSPU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |