C15H21ClN4O2 — CID 75379285
3-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-1-cyclopropyl-1-(2-hydroxyethyl)urea (PubChem CID 75379285) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 3-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-1-cyclopropyl-1-(2-hydroxyethyl)urea.
| Compound Name | 3-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-1-cyclopropyl-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 75379285 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-1-cyclopropyl-1-(2-hydroxyethyl)urea |
| SMILES | O=C(NC1CCN(c2ncccc2Cl)C1)N(CCO)C1CC1 |
| InChI | InChI=1S/C15H21ClN4O2/c16-13-2-1-6-17-14(13)19-7-5-11(10-19)18-15(22)20(8-9-21)12-3-4-12/h1-2,6,11-12,21H,3-5,7-10H2,(H,18,22) |
| InChIKey | GBHZGEVJQPTJGU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |