C15H19BrClN3OS — CID 163345044
[1-(5-bromo-3-chloro-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone (PubChem CID 163345044) has the molecular formula C15H19BrClN3OS and a molecular weight of 404.76 g/mol. Its IUPAC name is [1-(5-bromo-3-chloro-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-(5-bromo-3-chloro-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 163345044 |
| Molecular Formula | C15H19BrClN3OS |
| Molecular Weight | 404.76 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | [1-(5-bromo-3-chloro-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(C1CCCN(c2ncc(Br)cc2Cl)C1)N1CCSCC1 |
| InChI | InChI=1S/C15H19BrClN3OS/c16-12-8-13(17)14(18-9-12)20-3-1-2-11(10-20)15(21)19-4-6-22-7-5-19/h8-9,11H,1-7,10H2 |
| InChIKey | AOWOJVDFEIAGDK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |