C15H19BrFN3OS — CID 155974121
[1-(5-bromo-3-fluoro-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone (PubChem CID 155974121) has the molecular formula C15H19BrFN3OS and a molecular weight of 388.31 g/mol. Its IUPAC name is [1-(5-bromo-3-fluoro-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-(5-bromo-3-fluoro-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 155974121 |
| Molecular Formula | C15H19BrFN3OS |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | [1-(5-bromo-3-fluoro-2-pyridinyl)piperidin-3-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(C1CCCN(c2ncc(Br)cc2F)C1)N1CCSCC1 |
| InChI | InChI=1S/C15H19BrFN3OS/c16-12-8-13(17)14(18-9-12)20-3-1-2-11(10-20)15(21)19-4-6-22-7-5-19/h8-9,11H,1-7,10H2 |
| InChIKey | JZWGDMMPINVXJL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |