About 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane
2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane (PubChem CID 145378977) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane |
| PubChem CID | 145378977 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane |
| SMILES | CC.Cc1cncc(OCC(C)(C)C)n1 |
| InChI | InChI=1S/C10H16N2O.C2H6/c1-8-5-11-6-9(12-8)13-7-10(2,3)4;1-2/h5-6H,7H2,1-4H3;1-2H3 |
| InChIKey | HBULRGWGMVCIEA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane?
The IUPAC name of 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane (CID 145378977) is 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane.
What is the SMILES notation for 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane?
The canonical SMILES for 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane is CC.Cc1cncc(OCC(C)(C)C)n1.
What is the InChIKey of 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane?
The InChIKey is HBULRGWGMVCIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O.C2H6/c1-8-5-11-6-9(12-8)13-7-10(2,3)4;1-2/h5-6H,7H2,1-4H3;1-2H3.
What are the key properties of 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane?
2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane has a molecular weight of 210.32 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropoxy)-6-methylpyrazine;ethane is sourced from PubChem (CID 145378977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).