C11H17N3O2S — CID 174839312
cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid (PubChem CID 174839312) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid.
| Compound Name | cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 174839312 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid |
| SMILES | CSc1ncc(C(=O)O)cn1.NC1CCCC1 |
| InChI | InChI=1S/C6H6N2O2S.C5H11N/c1-11-6-7-2-4(3-8-6)5(9)10;6-5-3-1-2-4-5/h2-3H,1H3,(H,9,10);5H,1-4,6H2 |
| InChIKey | DCKWAQCSPZFARA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |