About cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid
cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid (PubChem CID 174839312) has the molecular formula C11H17N3O2S
and a molecular weight of 255.34 g/mol. Its IUPAC name is cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid |
| PubChem CID | 174839312 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid |
| SMILES | CSc1ncc(C(=O)O)cn1.NC1CCCC1 |
| InChI | InChI=1S/C6H6N2O2S.C5H11N/c1-11-6-7-2-4(3-8-6)5(9)10;6-5-3-1-2-4-5/h2-3H,1H3,(H,9,10);5H,1-4,6H2 |
| InChIKey | DCKWAQCSPZFARA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid?
The IUPAC name of cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid (CID 174839312) is cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid.
What is the SMILES notation for cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid?
The canonical SMILES for cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid is CSc1ncc(C(=O)O)cn1.NC1CCCC1.
What is the InChIKey of cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid?
The InChIKey is DCKWAQCSPZFARA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2S.C5H11N/c1-11-6-7-2-4(3-8-6)5(9)10;6-5-3-1-2-4-5/h2-3H,1H3,(H,9,10);5H,1-4,6H2.
What are the key properties of cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid?
cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid has a molecular weight of 255.34 g/mol, XLogP of 1.78, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanamine;2-methylsulfanylpyrimidine-5-carboxylic acid is sourced from PubChem (CID 174839312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).