C12H18N4OS — CID 86065477
4-(cyclohexylamino)-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 86065477) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is 4-(cyclohexylamino)-2-methylsulfanylpyrimidine-5-carboxamide.
| Compound Name | 4-(cyclohexylamino)-2-methylsulfanylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 86065477 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-(cyclohexylamino)-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(N)=O)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C12H18N4OS/c1-18-12-14-7-9(10(13)17)11(16-12)15-8-5-3-2-4-6-8/h7-8H,2-6H2,1H3,(H2,13,17)(H,14,15,16) |
| InChIKey | JVPBURAVUCETLI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |