C16H25N3OS — CID 125169236
[(4R)-4-tert-butylazepan-1-yl]-(2-methylsulfanylpyrimidin-5-yl)methanone (PubChem CID 125169236) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is [(4R)-4-tert-butylazepan-1-yl]-(2-methylsulfanylpyrimidin-5-yl)methanone.
| Compound Name | [(4R)-4-tert-butylazepan-1-yl]-(2-methylsulfanylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 125169236 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | [(4R)-4-tert-butylazepan-1-yl]-(2-methylsulfanylpyrimidin-5-yl)methanone |
| SMILES | CSc1ncc(C(=O)N2CCC[C@@H](C(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C16H25N3OS/c1-16(2,3)13-6-5-8-19(9-7-13)14(20)12-10-17-15(21-4)18-11-12/h10-11,13H,5-9H2,1-4H3/t13-/m1/s1 |
| InChIKey | IRHILZUEJJSXEK-CYBMUJFWSA-N |
| XLogP | 3.49 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |