C14H16Cl2N2O — CID 146450870
6-pyridin-2-yl-3,4-dihydro-2H-chromen-3-amine;dihydrochloride (PubChem CID 146450870) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 6-pyridin-2-yl-3,4-dihydro-2H-chromen-3-amine;dihydrochloride.
| Compound Name | 6-pyridin-2-yl-3,4-dihydro-2H-chromen-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 146450870 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 6-pyridin-2-yl-3,4-dihydro-2H-chromen-3-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1COc2ccc(-c3ccccn3)cc2C1 |
| InChI | InChI=1S/C14H14N2O.2ClH/c15-12-8-11-7-10(4-5-14(11)17-9-12)13-3-1-2-6-16-13;;/h1-7,12H,8-9,15H2;2*1H |
| InChIKey | GQADKDLFORKQEJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |