C20H26N2O — CID 144811894
ethane;2-hydroxy-2-(5-pyridin-2-yl-2,3-dihydro-1H-inden-2-yl)acetonitrile (PubChem CID 144811894) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is ethane;2-hydroxy-2-(5-pyridin-2-yl-2,3-dihydro-1H-inden-2-yl)acetonitrile.
| Compound Name | ethane;2-hydroxy-2-(5-pyridin-2-yl-2,3-dihydro-1H-inden-2-yl)acetonitrile |
|---|---|
| PubChem CID | 144811894 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | ethane;2-hydroxy-2-(5-pyridin-2-yl-2,3-dihydro-1H-inden-2-yl)acetonitrile |
| SMILES | CC.CC.N#CC(O)C1Cc2ccc(-c3ccccn3)cc2C1 |
| InChI | InChI=1S/C16H14N2O.2C2H6/c17-10-16(19)14-7-11-4-5-12(8-13(11)9-14)15-3-1-2-6-18-15;2*1-2/h1-6,8,14,16,19H,7,9H2;2*1-2H3 |
| InChIKey | IRGIYJKGHGNSCJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|