C9H9ClO2 — CID 101091624
[(2R)-6-chloro-2,3-dihydro-1-benzofuran-2-yl]methanol (PubChem CID 101091624) has the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. Its IUPAC name is [(2R)-6-chloro-2,3-dihydro-1-benzofuran-2-yl]methanol.
| Compound Name | [(2R)-6-chloro-2,3-dihydro-1-benzofuran-2-yl]methanol |
|---|---|
| PubChem CID | 101091624 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | [(2R)-6-chloro-2,3-dihydro-1-benzofuran-2-yl]methanol |
| SMILES | OC[C@H]1Cc2ccc(Cl)cc2O1 |
| InChI | InChI=1S/C9H9ClO2/c10-7-2-1-6-3-8(5-11)12-9(6)4-7/h1-2,4,8,11H,3,5H2/t8-/m1/s1 |
| InChIKey | WEVPVZMJEYAFKM-MRVPVSSYSA-N |
| XLogP | 1.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |