C8H7ClO3 — CID 115062717
(5-chloro-1,3-benzodioxol-2-yl)methanol (PubChem CID 115062717) has the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. Its IUPAC name is (5-chloro-1,3-benzodioxol-2-yl)methanol.
| Compound Name | (5-chloro-1,3-benzodioxol-2-yl)methanol |
|---|---|
| PubChem CID | 115062717 |
| Molecular Formula | C8H7ClO3 |
| Molecular Weight | 186.59 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | (5-chloro-1,3-benzodioxol-2-yl)methanol |
| SMILES | OCC1Oc2ccc(Cl)cc2O1 |
| InChI | InChI=1S/C8H7ClO3/c9-5-1-2-6-7(3-5)12-8(4-10)11-6/h1-3,8,10H,4H2 |
| InChIKey | SXZFBWAPQKKLLR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.59 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |