3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid

C10H9ClO4 — CID 84692155

IUPAC3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid
SMILESO=C(O)CCC1Oc2ccc(Cl)cc2O1
InChIInChI=1S/C10H9ClO4/c11-6-1-2-7-8(5-6)15-10(14-7)4-3-9(12)13/h1-2,5,10H,3-4H2,(H,12,13)
InChIKeyNRIXIEFSKRYLTG-UHFFFAOYSA-N
MW228.63 g/mol
LogP2.30
Rot. Bonds3

About 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid

3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid (PubChem CID 84692155) has the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. Its IUPAC name is 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid
PubChem CID84692155
Molecular FormulaC10H9ClO4
Molecular Weight228.63 g/mol
Exact Mass228.02
IUPAC Name3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid
SMILESO=C(O)CCC1Oc2ccc(Cl)cc2O1
InChIInChI=1S/C10H9ClO4/c11-6-1-2-7-8(5-6)15-10(14-7)4-3-9(12)13/h1-2,5,10H,3-4H2,(H,12,13)
InChIKeyNRIXIEFSKRYLTG-UHFFFAOYSA-N
XLogP2.30
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.63
LogP ≤ 52.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid?
The IUPAC name of 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid (CID 84692155) is 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid.
What is the SMILES notation for 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid?
The canonical SMILES for 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid is O=C(O)CCC1Oc2ccc(Cl)cc2O1.
What is the InChIKey of 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid?
The InChIKey is NRIXIEFSKRYLTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO4/c11-6-1-2-7-8(5-6)15-10(14-7)4-3-9(12)13/h1-2,5,10H,3-4H2,(H,12,13).
What are the key properties of 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid?
3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid has a molecular weight of 228.63 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-1,3-benzodioxol-2-yl)propanoic acid is sourced from PubChem (CID 84692155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).