C17H14ClNO4 — CID 24738904
3-(6-chloro-3-oxo-2-phenyl-1,4-benzoxazin-4-yl)propanoic acid (PubChem CID 24738904) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is 3-(6-chloro-3-oxo-2-phenyl-1,4-benzoxazin-4-yl)propanoic acid.
| Compound Name | 3-(6-chloro-3-oxo-2-phenyl-1,4-benzoxazin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 24738904 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3-(6-chloro-3-oxo-2-phenyl-1,4-benzoxazin-4-yl)propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C(c2ccccc2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H14ClNO4/c18-12-6-7-14-13(10-12)19(9-8-15(20)21)17(22)16(23-14)11-4-2-1-3-5-11/h1-7,10,16H,8-9H2,(H,20,21) |
| InChIKey | GIMBFKVNVZXNST-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |