C13H12ClNO4 — CID 82025803
2-(6-chloro-3-oxo-4-prop-2-enyl-1,4-benzoxazin-2-yl)acetic acid (PubChem CID 82025803) has the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-4-prop-2-enyl-1,4-benzoxazin-2-yl)acetic acid.
| Compound Name | 2-(6-chloro-3-oxo-4-prop-2-enyl-1,4-benzoxazin-2-yl)acetic acid |
|---|---|
| PubChem CID | 82025803 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-(6-chloro-3-oxo-4-prop-2-enyl-1,4-benzoxazin-2-yl)acetic acid |
| SMILES | C=CCN1C(=O)C(CC(=O)O)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H12ClNO4/c1-2-5-15-9-6-8(14)3-4-10(9)19-11(13(15)18)7-12(16)17/h2-4,6,11H,1,5,7H2,(H,16,17) |
| InChIKey | FKDJKODWRVYEET-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|