C19H19NO4 — CID 24738900
3-(6,8-dimethyl-3-oxo-2-phenyl-1,4-benzoxazin-4-yl)propanoic acid (PubChem CID 24738900) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 3-(6,8-dimethyl-3-oxo-2-phenyl-1,4-benzoxazin-4-yl)propanoic acid.
| Compound Name | 3-(6,8-dimethyl-3-oxo-2-phenyl-1,4-benzoxazin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 24738900 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-(6,8-dimethyl-3-oxo-2-phenyl-1,4-benzoxazin-4-yl)propanoic acid |
| SMILES | Cc1cc(C)c2c(c1)N(CCC(=O)O)C(=O)C(c1ccccc1)O2 |
| InChI | InChI=1S/C19H19NO4/c1-12-10-13(2)17-15(11-12)20(9-8-16(21)22)19(23)18(24-17)14-6-4-3-5-7-14/h3-7,10-11,18H,8-9H2,1-2H3,(H,21,22) |
| InChIKey | RYEVIMRBVIUSBB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |