C15H20ClNO3 — CID 82880950
3-[tert-butyl-(5-chloro-2-methylbenzoyl)amino]propanoic acid (PubChem CID 82880950) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 3-[tert-butyl-(5-chloro-2-methylbenzoyl)amino]propanoic acid.
| Compound Name | 3-[tert-butyl-(5-chloro-2-methylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82880950 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-[tert-butyl-(5-chloro-2-methylbenzoyl)amino]propanoic acid |
| SMILES | Cc1ccc(Cl)cc1C(=O)N(CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H20ClNO3/c1-10-5-6-11(16)9-12(10)14(20)17(15(2,3)4)8-7-13(18)19/h5-6,9H,7-8H2,1-4H3,(H,18,19) |
| InChIKey | XVWNKIHWCWNFMU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |