C16H23NO3 — CID 60826033
3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid (PubChem CID 60826033) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid.
| Compound Name | 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 60826033 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid |
| SMILES | Cc1cccc(C(=O)N(CCC(=O)O)C(C)(C)C)c1C |
| InChI | InChI=1S/C16H23NO3/c1-11-7-6-8-13(12(11)2)15(20)17(16(3,4)5)10-9-14(18)19/h6-8H,9-10H2,1-5H3,(H,18,19) |
| InChIKey | YFWZCTDMJUBAKP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |