3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid

C16H23NO3 — CID 60826033

IUPAC3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid
SMILESCc1cccc(C(=O)N(CCC(=O)O)C(C)(C)C)c1C
InChIInChI=1S/C16H23NO3/c1-11-7-6-8-13(12(11)2)15(20)17(16(3,4)5)10-9-14(18)19/h6-8H,9-10H2,1-5H3,(H,18,19)
InChIKeyYFWZCTDMJUBAKP-UHFFFAOYSA-N
MW277.36 g/mol
LogP3.02
Rot. Bonds4

About 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid

3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid (PubChem CID 60826033) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid
PubChem CID60826033
Molecular FormulaC16H23NO3
Molecular Weight277.36 g/mol
Exact Mass277.17
IUPAC Name3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid
SMILESCc1cccc(C(=O)N(CCC(=O)O)C(C)(C)C)c1C
InChIInChI=1S/C16H23NO3/c1-11-7-6-8-13(12(11)2)15(20)17(16(3,4)5)10-9-14(18)19/h6-8H,9-10H2,1-5H3,(H,18,19)
InChIKeyYFWZCTDMJUBAKP-UHFFFAOYSA-N
XLogP3.02
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.36
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid?
The IUPAC name of 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid (CID 60826033) is 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid.
What is the SMILES notation for 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid?
The canonical SMILES for 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid is Cc1cccc(C(=O)N(CCC(=O)O)C(C)(C)C)c1C.
What is the InChIKey of 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid?
The InChIKey is YFWZCTDMJUBAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-11-7-6-8-13(12(11)2)15(20)17(16(3,4)5)10-9-14(18)19/h6-8H,9-10H2,1-5H3,(H,18,19).
What are the key properties of 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid?
3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid has a molecular weight of 277.36 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl-(2,3-dimethylbenzoyl)amino]propanoic acid is sourced from PubChem (CID 60826033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).