C10H11ClO4 — CID 67761834
5-chloro-1,3-benzodioxole;propanoic acid (PubChem CID 67761834) has the molecular formula C10H11ClO4 and a molecular weight of 230.65 g/mol. Its IUPAC name is 5-chloro-1,3-benzodioxole;propanoic acid.
| Compound Name | 5-chloro-1,3-benzodioxole;propanoic acid |
|---|---|
| PubChem CID | 67761834 |
| Molecular Formula | C10H11ClO4 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 5-chloro-1,3-benzodioxole;propanoic acid |
| SMILES | CCC(=O)O.Clc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H5ClO2.C3H6O2/c8-5-1-2-6-7(3-5)10-4-9-6;1-2-3(4)5/h1-3H,4H2;2H2,1H3,(H,4,5) |
| InChIKey | DBBUZTZTYTYYFK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |