5-chloro-1,3-benzodioxole;propanoic acid

C10H11ClO4 — CID 67761834

IUPAC5-chloro-1,3-benzodioxole;propanoic acid
SMILESCCC(=O)O.Clc1ccc2c(c1)OCO2
InChIInChI=1S/C7H5ClO2.C3H6O2/c8-5-1-2-6-7(3-5)10-4-9-6;1-2-3(4)5/h1-3H,4H2;2H2,1H3,(H,4,5)
InChIKeyDBBUZTZTYTYYFK-UHFFFAOYSA-N
MW230.65 g/mol
LogP2.55
Rot. Bonds1

About 5-chloro-1,3-benzodioxole;propanoic acid

5-chloro-1,3-benzodioxole;propanoic acid (PubChem CID 67761834) has the molecular formula C10H11ClO4 and a molecular weight of 230.65 g/mol. Its IUPAC name is 5-chloro-1,3-benzodioxole;propanoic acid.

Molecular Properties

Compound Name5-chloro-1,3-benzodioxole;propanoic acid
PubChem CID67761834
Molecular FormulaC10H11ClO4
Molecular Weight230.65 g/mol
Exact Mass230.03
IUPAC Name5-chloro-1,3-benzodioxole;propanoic acid
SMILESCCC(=O)O.Clc1ccc2c(c1)OCO2
InChIInChI=1S/C7H5ClO2.C3H6O2/c8-5-1-2-6-7(3-5)10-4-9-6;1-2-3(4)5/h1-3H,4H2;2H2,1H3,(H,4,5)
InChIKeyDBBUZTZTYTYYFK-UHFFFAOYSA-N
XLogP2.55
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.65
LogP ≤ 52.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-chloro-1,3-benzodioxole;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-1,3-benzodioxole;propanoic acid?
The IUPAC name of 5-chloro-1,3-benzodioxole;propanoic acid (CID 67761834) is 5-chloro-1,3-benzodioxole;propanoic acid.
What is the SMILES notation for 5-chloro-1,3-benzodioxole;propanoic acid?
The canonical SMILES for 5-chloro-1,3-benzodioxole;propanoic acid is CCC(=O)O.Clc1ccc2c(c1)OCO2.
What is the InChIKey of 5-chloro-1,3-benzodioxole;propanoic acid?
The InChIKey is DBBUZTZTYTYYFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO2.C3H6O2/c8-5-1-2-6-7(3-5)10-4-9-6;1-2-3(4)5/h1-3H,4H2;2H2,1H3,(H,4,5).
What are the key properties of 5-chloro-1,3-benzodioxole;propanoic acid?
5-chloro-1,3-benzodioxole;propanoic acid has a molecular weight of 230.65 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-benzodioxole;propanoic acid is sourced from PubChem (CID 67761834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).