C18H20Cl2N2O2 — CID 144987793
azepan-3-ol;3,7-dichloro-10H-phenoxazine (PubChem CID 144987793) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is azepan-3-ol;3,7-dichloro-10H-phenoxazine.
| Compound Name | azepan-3-ol;3,7-dichloro-10H-phenoxazine |
|---|---|
| PubChem CID | 144987793 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | azepan-3-ol;3,7-dichloro-10H-phenoxazine |
| SMILES | Clc1ccc2c(c1)Oc1cc(Cl)ccc1N2.OC1CCCCNC1 |
| InChI | InChI=1S/C12H7Cl2NO.C6H13NO/c13-7-1-3-9-11(5-7)16-12-6-8(14)2-4-10(12)15-9;8-6-3-1-2-4-7-5-6/h1-6,15H;6-8H,1-5H2 |
| InChIKey | PXYPVGUECMUJFL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |