C9H8ClNO2 — CID 84667919
8-chloro-4,5-dihydro-3H-1,5-benzoxazepin-2-one (PubChem CID 84667919) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is 8-chloro-4,5-dihydro-3H-1,5-benzoxazepin-2-one.
| Compound Name | 8-chloro-4,5-dihydro-3H-1,5-benzoxazepin-2-one |
|---|---|
| PubChem CID | 84667919 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 8-chloro-4,5-dihydro-3H-1,5-benzoxazepin-2-one |
| SMILES | O=C1CCNc2ccc(Cl)cc2O1 |
| InChI | InChI=1S/C9H8ClNO2/c10-6-1-2-7-8(5-6)13-9(12)3-4-11-7/h1-2,5,11H,3-4H2 |
| InChIKey | MHSCWJKKKSMTRG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|