C11H12ClNO — CID 142567432
8-chloro-2,3,4,5-tetrahydro-1H-1-benzazocin-6-one (PubChem CID 142567432) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 8-chloro-2,3,4,5-tetrahydro-1H-1-benzazocin-6-one.
| Compound Name | 8-chloro-2,3,4,5-tetrahydro-1H-1-benzazocin-6-one |
|---|---|
| PubChem CID | 142567432 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 8-chloro-2,3,4,5-tetrahydro-1H-1-benzazocin-6-one |
| SMILES | O=C1CCCCNc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H12ClNO/c12-8-4-5-10-9(7-8)11(14)3-1-2-6-13-10/h4-5,7,13H,1-3,6H2 |
| InChIKey | YOFNAWCMZMEXLD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |