C14H12ClNO2 — CID 10264656
(3E)-5-chloro-3-(2-oxocyclohexylidene)-1H-indol-2-one (PubChem CID 10264656) has the molecular formula C14H12ClNO2 and a molecular weight of 261.71 g/mol. Its IUPAC name is (3E)-5-chloro-3-(2-oxocyclohexylidene)-1H-indol-2-one.
| Compound Name | (3E)-5-chloro-3-(2-oxocyclohexylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 10264656 |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (3E)-5-chloro-3-(2-oxocyclohexylidene)-1H-indol-2-one |
| SMILES | O=C1CCCC/C1=C1\C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H12ClNO2/c15-8-5-6-11-10(7-8)13(14(18)16-11)9-3-1-2-4-12(9)17/h5-7H,1-4H2,(H,16,18)/b13-9+ |
| InChIKey | UFWPRNMYFSCBDD-UKTHLTGXSA-N |
| XLogP | 3.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|