C11H16F2N2O — CID 158309036
3,4-difluoroaniline;piperidin-3-ol (PubChem CID 158309036) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 3,4-difluoroaniline;piperidin-3-ol.
| Compound Name | 3,4-difluoroaniline;piperidin-3-ol |
|---|---|
| PubChem CID | 158309036 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3,4-difluoroaniline;piperidin-3-ol |
| SMILES | Nc1ccc(F)c(F)c1.OC1CCCNC1 |
| InChI | InChI=1S/C6H5F2N.C5H11NO/c7-5-2-1-4(9)3-6(5)8;7-5-2-1-3-6-4-5/h1-3H,9H2;5-7H,1-4H2 |
| InChIKey | GNLIAFZNIQTULZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|