C8H9NOS — CID 91370754
6-methyl-1H-4,2,1-benzoxathiazine (PubChem CID 91370754) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is 6-methyl-1H-4,2,1-benzoxathiazine.
| Compound Name | 6-methyl-1H-4,2,1-benzoxathiazine |
|---|---|
| PubChem CID | 91370754 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 6-methyl-1H-4,2,1-benzoxathiazine |
| SMILES | Cc1ccc2c(c1)OCSN2 |
| InChI | InChI=1S/C8H9NOS/c1-6-2-3-7-8(4-6)10-5-11-9-7/h2-4,9H,5H2,1H3 |
| InChIKey | BWUOBKVJTIIKSP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|