C13H18N2O — CID 115098560
3,3,5,7-tetramethyl-1,4-dihydro-1,5-benzodiazepin-2-one (PubChem CID 115098560) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3,3,5,7-tetramethyl-1,4-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | 3,3,5,7-tetramethyl-1,4-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 115098560 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3,3,5,7-tetramethyl-1,4-dihydro-1,5-benzodiazepin-2-one |
| SMILES | Cc1ccc2c(c1)N(C)CC(C)(C)C(=O)N2 |
| InChI | InChI=1S/C13H18N2O/c1-9-5-6-10-11(7-9)15(4)8-13(2,3)12(16)14-10/h5-7H,8H2,1-4H3,(H,14,16) |
| InChIKey | CJNYIBSEHWRTMR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |