C14H15F2NO — CID 106702132
4',4'-difluoro-5-methylspiro[1H-indole-3,1'-cyclohexane]-2-one (PubChem CID 106702132) has the molecular formula C14H15F2NO and a molecular weight of 251.28 g/mol. Its IUPAC name is 4',4'-difluoro-5-methylspiro[1H-indole-3,1'-cyclohexane]-2-one.
| Compound Name | 4',4'-difluoro-5-methylspiro[1H-indole-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 106702132 |
| Molecular Formula | C14H15F2NO |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4',4'-difluoro-5-methylspiro[1H-indole-3,1'-cyclohexane]-2-one |
| SMILES | Cc1ccc2c(c1)C1(CCC(F)(F)CC1)C(=O)N2 |
| InChI | InChI=1S/C14H15F2NO/c1-9-2-3-11-10(8-9)13(12(18)17-11)4-6-14(15,16)7-5-13/h2-3,8H,4-7H2,1H3,(H,17,18) |
| InChIKey | FGGKZCYCZUIJOK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |