C10H7F2NO — CID 164588624
5,6-difluorospiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 164588624) has the molecular formula C10H7F2NO and a molecular weight of 195.17 g/mol. Its IUPAC name is 5,6-difluorospiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | 5,6-difluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 164588624 |
| Molecular Formula | C10H7F2NO |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 5,6-difluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | O=C1Nc2cc(F)c(F)cc2C12CC2 |
| InChI | InChI=1S/C10H7F2NO/c11-6-3-5-8(4-7(6)12)13-9(14)10(5)1-2-10/h3-4H,1-2H2,(H,13,14) |
| InChIKey | QTCAFXNHTHYTCB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |