C13H15FN2O — CID 84627749
4'-amino-6-fluorospiro[1H-indole-3,1'-cyclohexane]-2-one (PubChem CID 84627749) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 4'-amino-6-fluorospiro[1H-indole-3,1'-cyclohexane]-2-one.
| Compound Name | 4'-amino-6-fluorospiro[1H-indole-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 84627749 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4'-amino-6-fluorospiro[1H-indole-3,1'-cyclohexane]-2-one |
| SMILES | NC1CCC2(CC1)C(=O)Nc1cc(F)ccc12 |
| InChI | InChI=1S/C13H15FN2O/c14-8-1-2-10-11(7-8)16-12(17)13(10)5-3-9(15)4-6-13/h1-2,7,9H,3-6,15H2,(H,16,17) |
| InChIKey | VNOLFBGERFTLME-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |