C11H9F2NO2 — CID 106702093
5-(difluoromethoxy)spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 106702093) has the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. Its IUPAC name is 5-(difluoromethoxy)spiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | 5-(difluoromethoxy)spiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 106702093 |
| Molecular Formula | C11H9F2NO2 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 5-(difluoromethoxy)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | O=C1Nc2ccc(OC(F)F)cc2C12CC2 |
| InChI | InChI=1S/C11H9F2NO2/c12-10(13)16-6-1-2-8-7(5-6)11(3-4-11)9(15)14-8/h1-2,5,10H,3-4H2,(H,14,15) |
| InChIKey | WQTUOWGFQKWHJF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |